C24H32N2O2 — CID 70807228
7-[3-(azetidin-1-yl)propoxy]-4-(4-methoxyphenyl)-2,6-dimethyl-3,4-dihydro-1H-isoquinoline (PubChem CID 70807228) has the molecular formula C24H32N2O2 and a molecular weight of 380.53 g/mol. Its IUPAC name is 7-[3-(azetidin-1-yl)propoxy]-4-(4-methoxyphenyl)-2,6-dimethyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | 7-[3-(azetidin-1-yl)propoxy]-4-(4-methoxyphenyl)-2,6-dimethyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 70807228 |
| Molecular Formula | C24H32N2O2 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | 7-[3-(azetidin-1-yl)propoxy]-4-(4-methoxyphenyl)-2,6-dimethyl-3,4-dihydro-1H-isoquinoline |
| SMILES | COc1ccc(C2CN(C)Cc3cc(OCCCN4CCC4)c(C)cc32)cc1 |
| InChI | InChI=1S/C24H32N2O2/c1-18-14-22-20(15-24(18)28-13-5-12-26-10-4-11-26)16-25(2)17-23(22)19-6-8-21(27-3)9-7-19/h6-9,14-15,23H,4-5,10-13,16-17H2,1-3H3 |
| InChIKey | SVAKGXPHHHDGOH-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|