C24H31FN2OS — CID 143247921
4-[7-[3-(4-fluoropiperidin-1-yl)propoxy]-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl]benzenethiol (PubChem CID 143247921) has the molecular formula C24H31FN2OS and a molecular weight of 414.59 g/mol. Its IUPAC name is 4-[7-[3-(4-fluoropiperidin-1-yl)propoxy]-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl]benzenethiol.
| Compound Name | 4-[7-[3-(4-fluoropiperidin-1-yl)propoxy]-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl]benzenethiol |
|---|---|
| PubChem CID | 143247921 |
| Molecular Formula | C24H31FN2OS |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | 4-[7-[3-(4-fluoropiperidin-1-yl)propoxy]-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl]benzenethiol |
| SMILES | CN1Cc2cc(OCCCN3CCC(F)CC3)ccc2C(c2ccc(S)cc2)C1 |
| InChI | InChI=1S/C24H31FN2OS/c1-26-16-19-15-21(28-14-2-11-27-12-9-20(25)10-13-27)5-8-23(19)24(17-26)18-3-6-22(29)7-4-18/h3-8,15,20,24,29H,2,9-14,16-17H2,1H3 |
| InChIKey | IELSARHLDOPJAW-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 15.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|