C26H32FN5O — CID 57447828
7-[3-(4-fluoropiperidin-1-yl)propoxy]-2-methyl-4-(6-pyrazol-1-yl-3-pyridinyl)-3,4-dihydro-1H-isoquinoline (PubChem CID 57447828) has the molecular formula C26H32FN5O and a molecular weight of 449.57 g/mol. Its IUPAC name is 7-[3-(4-fluoropiperidin-1-yl)propoxy]-2-methyl-4-(6-pyrazol-1-yl-3-pyridinyl)-3,4-dihydro-1H-isoquinoline.
| Compound Name | 7-[3-(4-fluoropiperidin-1-yl)propoxy]-2-methyl-4-(6-pyrazol-1-yl-3-pyridinyl)-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 57447828 |
| Molecular Formula | C26H32FN5O |
| Molecular Weight | 449.57 g/mol |
| Exact Mass | 449.26 |
| IUPAC Name | 7-[3-(4-fluoropiperidin-1-yl)propoxy]-2-methyl-4-(6-pyrazol-1-yl-3-pyridinyl)-3,4-dihydro-1H-isoquinoline |
| SMILES | CN1Cc2cc(OCCCN3CCC(F)CC3)ccc2C(c2ccc(-n3cccn3)nc2)C1 |
| InChI | InChI=1S/C26H32FN5O/c1-30-18-21-16-23(33-15-3-11-31-13-8-22(27)9-14-31)5-6-24(21)25(19-30)20-4-7-26(28-17-20)32-12-2-10-29-32/h2,4-7,10,12,16-17,22,25H,3,8-9,11,13-15,18-19H2,1H3 |
| InChIKey | DOGZCKPRKDLMRP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 46.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.57 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|