C18H26BNO5 — CID 174054978
(2S,5R)-2-methyl-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]morpholine-4-carboxylic acid (PubChem CID 174054978) has the molecular formula C18H26BNO5 and a molecular weight of 347.22 g/mol. Its IUPAC name is (2S,5R)-2-methyl-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]morpholine-4-carboxylic acid.
| Compound Name | (2S,5R)-2-methyl-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]morpholine-4-carboxylic acid |
|---|---|
| PubChem CID | 174054978 |
| Molecular Formula | C18H26BNO5 |
| Molecular Weight | 347.22 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | (2S,5R)-2-methyl-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]morpholine-4-carboxylic acid |
| SMILES | C[C@H]1CN(C(=O)O)[C@H](c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)CO1 |
| InChI | InChI=1S/C18H26BNO5/c1-12-10-20(16(21)22)15(11-23-12)13-6-8-14(9-7-13)19-24-17(2,3)18(4,5)25-19/h6-9,12,15H,10-11H2,1-5H3,(H,21,22)/t12-,15-/m0/s1 |
| InChIKey | YTFFFCRHDBXSGL-WFASDCNBSA-N |
| XLogP | 2.43 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.22 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|