C17H22BNO5 — CID 174215214
(1S,9S)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-8-oxa-11-azatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-11-carboxylic acid (PubChem CID 174215214) has the molecular formula C17H22BNO5 and a molecular weight of 331.18 g/mol. Its IUPAC name is (1S,9S)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-8-oxa-11-azatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-11-carboxylic acid.
| Compound Name | (1S,9S)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-8-oxa-11-azatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-11-carboxylic acid |
|---|---|
| PubChem CID | 174215214 |
| Molecular Formula | C17H22BNO5 |
| Molecular Weight | 331.18 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | (1S,9S)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-8-oxa-11-azatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-11-carboxylic acid |
| SMILES | CC1(C)OB(c2ccc3c(c2)[C@@H]2C[C@@H](CN2C(=O)O)O3)OC1(C)C |
| InChI | InChI=1S/C17H22BNO5/c1-16(2)17(3,4)24-18(23-16)10-5-6-14-12(7-10)13-8-11(22-14)9-19(13)15(20)21/h5-7,11,13H,8-9H2,1-4H3,(H,20,21)/t11-,13-/m0/s1 |
| InChIKey | AWQCLMLQPPXWDK-AAEUAGOBSA-N |
| XLogP | 2.17 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.18 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|