C16H22BNO5 — CID 68537224
[(4S)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-chromen-4-yl]carbamic acid (PubChem CID 68537224) has the molecular formula C16H22BNO5 and a molecular weight of 319.17 g/mol. Its IUPAC name is [(4S)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-chromen-4-yl]carbamic acid.
| Compound Name | [(4S)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-chromen-4-yl]carbamic acid |
|---|---|
| PubChem CID | 68537224 |
| Molecular Formula | C16H22BNO5 |
| Molecular Weight | 319.17 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | [(4S)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-chromen-4-yl]carbamic acid |
| SMILES | CC1(C)OB(c2ccc3c(c2)[C@@H](NC(=O)O)CCO3)OC1(C)C |
| InChI | InChI=1S/C16H22BNO5/c1-15(2)16(3,4)23-17(22-15)10-5-6-13-11(9-10)12(7-8-21-13)18-14(19)20/h5-6,9,12,18H,7-8H2,1-4H3,(H,19,20)/t12-/m0/s1 |
| InChIKey | CNJXFSDODLYZBZ-LBPRGKRZSA-N |
| XLogP | 2.08 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.17 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|