C22H27BF3NO5 — CID 158615344
N-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-chromen-4-yl]-1-(3,3,3-trifluoro-2-oxopropyl)cyclopropane-1-carboxamide (PubChem CID 158615344) has the molecular formula C22H27BF3NO5 and a molecular weight of 453.27 g/mol. Its IUPAC name is N-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-chromen-4-yl]-1-(3,3,3-trifluoro-2-oxopropyl)cyclopropane-1-carboxamide.
| Compound Name | N-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-chromen-4-yl]-1-(3,3,3-trifluoro-2-oxopropyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 158615344 |
| Molecular Formula | C22H27BF3NO5 |
| Molecular Weight | 453.27 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | N-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-chromen-4-yl]-1-(3,3,3-trifluoro-2-oxopropyl)cyclopropane-1-carboxamide |
| SMILES | CC1(C)OB(c2ccc3c(c2)OCCC3NC(=O)C2(CC(=O)C(F)(F)F)CC2)OC1(C)C |
| InChI | InChI=1S/C22H27BF3NO5/c1-19(2)20(3,4)32-23(31-19)13-5-6-14-15(7-10-30-16(14)11-13)27-18(29)21(8-9-21)12-17(28)22(24,25)26/h5-6,11,15H,7-10,12H2,1-4H3,(H,27,29) |
| InChIKey | HXIAAUBRAWYBPS-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.27 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|