C19H28BNO5 — CID 174055084
3,3-dimethyl-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]morpholine-4-carboxylic acid (PubChem CID 174055084) has the molecular formula C19H28BNO5 and a molecular weight of 361.25 g/mol. Its IUPAC name is 3,3-dimethyl-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]morpholine-4-carboxylic acid.
| Compound Name | 3,3-dimethyl-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]morpholine-4-carboxylic acid |
|---|---|
| PubChem CID | 174055084 |
| Molecular Formula | C19H28BNO5 |
| Molecular Weight | 361.25 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | 3,3-dimethyl-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]morpholine-4-carboxylic acid |
| SMILES | CC1(C)COCC(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)N1C(=O)O |
| InChI | InChI=1S/C19H28BNO5/c1-17(2)12-24-11-15(21(17)16(22)23)13-7-9-14(10-8-13)20-25-18(3,4)19(5,6)26-20/h7-10,15H,11-12H2,1-6H3,(H,22,23) |
| InChIKey | CHRLHUSNFVESQL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.25 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|