C22H32BNO3 — CID 172552427
1-[1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-1-yl]piperidin-4-yl]ethanone (PubChem CID 172552427) has the molecular formula C22H32BNO3 and a molecular weight of 369.31 g/mol. Its IUPAC name is 1-[1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-1-yl]piperidin-4-yl]ethanone.
| Compound Name | 1-[1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-1-yl]piperidin-4-yl]ethanone |
|---|---|
| PubChem CID | 172552427 |
| Molecular Formula | C22H32BNO3 |
| Molecular Weight | 369.31 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | 1-[1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-1-yl]piperidin-4-yl]ethanone |
| SMILES | CC(=O)C1CCN(C2CCc3cc(B4OC(C)(C)C(C)(C)O4)ccc32)CC1 |
| InChI | InChI=1S/C22H32BNO3/c1-15(25)16-10-12-24(13-11-16)20-9-6-17-14-18(7-8-19(17)20)23-26-21(2,3)22(4,5)27-23/h7-8,14,16,20H,6,9-13H2,1-5H3 |
| InChIKey | LWNTXSQXELKDJR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.31 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|