C26H38BFN2O5 — CID 140511938
tert-butyl N-[(1S)-2-[(3S)-3-fluoropyrrolidin-1-yl]-2-oxo-1-[(1S)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-1-yl]ethyl]carbamate (PubChem CID 140511938) has the molecular formula C26H38BFN2O5 and a molecular weight of 488.41 g/mol. Its IUPAC name is tert-butyl N-[(1S)-2-[(3S)-3-fluoropyrrolidin-1-yl]-2-oxo-1-[(1S)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-1-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-2-[(3S)-3-fluoropyrrolidin-1-yl]-2-oxo-1-[(1S)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-1-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 140511938 |
| Molecular Formula | C26H38BFN2O5 |
| Molecular Weight | 488.41 g/mol |
| Exact Mass | 488.29 |
| IUPAC Name | tert-butyl N-[(1S)-2-[(3S)-3-fluoropyrrolidin-1-yl]-2-oxo-1-[(1S)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-1-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](C(=O)N1CC[C@H](F)C1)[C@H]1CCc2cc(B3OC(C)(C)C(C)(C)O3)ccc21 |
| InChI | InChI=1S/C26H38BFN2O5/c1-24(2,3)33-23(32)29-21(22(31)30-13-12-18(28)15-30)20-10-8-16-14-17(9-11-19(16)20)27-34-25(4,5)26(6,7)35-27/h9,11,14,18,20-21H,8,10,12-13,15H2,1-7H3,(H,29,32)/t18-,20-,21-/m0/s1 |
| InChIKey | VHCXSIBVLVZQOL-JBACZVJFSA-N |
| XLogP | 3.48 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|