C26H39BN2O7 — CID 168880501
methyl (3R)-1-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanoyl]pyrrolidine-3-carboxylate (PubChem CID 168880501) has the molecular formula C26H39BN2O7 and a molecular weight of 502.42 g/mol. Its IUPAC name is methyl (3R)-1-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanoyl]pyrrolidine-3-carboxylate.
| Compound Name | methyl (3R)-1-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanoyl]pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 168880501 |
| Molecular Formula | C26H39BN2O7 |
| Molecular Weight | 502.42 g/mol |
| Exact Mass | 502.29 |
| IUPAC Name | methyl (3R)-1-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanoyl]pyrrolidine-3-carboxylate |
| SMILES | COC(=O)[C@@H]1CCN(C(=O)[C@H](Cc2cccc(B3OC(C)(C)C(C)(C)O3)c2)NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C26H39BN2O7/c1-24(2,3)34-23(32)28-20(21(30)29-13-12-18(16-29)22(31)33-8)15-17-10-9-11-19(14-17)27-35-25(4,5)26(6,7)36-27/h9-11,14,18,20H,12-13,15-16H2,1-8H3,(H,28,32)/t18-,20+/m1/s1 |
| InChIKey | XMLDPSRQSHZBSO-QUCCMNQESA-N |
| XLogP | 2.44 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.42 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|