C25H40BN3O5 — CID 175966667
tert-butyl N-[(2S)-1-(2-methyldiazinan-1-yl)-1-oxo-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-2-yl]carbamate (PubChem CID 175966667) has the molecular formula C25H40BN3O5 and a molecular weight of 473.42 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(2-methyldiazinan-1-yl)-1-oxo-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-(2-methyldiazinan-1-yl)-1-oxo-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 175966667 |
| Molecular Formula | C25H40BN3O5 |
| Molecular Weight | 473.42 g/mol |
| Exact Mass | 473.31 |
| IUPAC Name | tert-butyl N-[(2S)-1-(2-methyldiazinan-1-yl)-1-oxo-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-2-yl]carbamate |
| SMILES | CN1CCCCN1C(=O)[C@H](Cc1cccc(B2OC(C)(C)C(C)(C)O2)c1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H40BN3O5/c1-23(2,3)32-22(31)27-20(21(30)29-15-10-9-14-28(29)8)17-18-12-11-13-19(16-18)26-33-24(4,5)25(6,7)34-26/h11-13,16,20H,9-10,14-15,17H2,1-8H3,(H,27,31)/t20-/m0/s1 |
| InChIKey | RKAGIIYOFKGDKI-FQEVSTJZSA-N |
| XLogP | 2.89 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|