C26H40BN3O7 — CID 175291898
methyl 1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanoyl]diazinane-3-carboxylate (PubChem CID 175291898) has the molecular formula C26H40BN3O7 and a molecular weight of 517.43 g/mol. Its IUPAC name is methyl 1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanoyl]diazinane-3-carboxylate.
| Compound Name | methyl 1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanoyl]diazinane-3-carboxylate |
|---|---|
| PubChem CID | 175291898 |
| Molecular Formula | C26H40BN3O7 |
| Molecular Weight | 517.43 g/mol |
| Exact Mass | 517.30 |
| IUPAC Name | methyl 1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanoyl]diazinane-3-carboxylate |
| SMILES | COC(=O)C1CCCN(C(=O)C(Cc2cccc(B3OC(C)(C)C(C)(C)O3)c2)NC(=O)OC(C)(C)C)N1 |
| InChI | InChI=1S/C26H40BN3O7/c1-24(2,3)35-23(33)28-20(21(31)30-14-10-13-19(29-30)22(32)34-8)16-17-11-9-12-18(15-17)27-36-25(4,5)26(6,7)37-27/h9,11-12,15,19-20,29H,10,13-14,16H2,1-8H3,(H,28,33) |
| InChIKey | PLJUBEGCAZGRJL-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.43 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|