C27H40BF2N3O7 — CID 156678993
methyl (3S)-1-[(2S)-3-[3-(difluoromethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]diazinane-3-carboxylate (PubChem CID 156678993) has the molecular formula C27H40BF2N3O7 and a molecular weight of 567.44 g/mol. Its IUPAC name is methyl (3S)-1-[(2S)-3-[3-(difluoromethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]diazinane-3-carboxylate.
| Compound Name | methyl (3S)-1-[(2S)-3-[3-(difluoromethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]diazinane-3-carboxylate |
|---|---|
| PubChem CID | 156678993 |
| Molecular Formula | C27H40BF2N3O7 |
| Molecular Weight | 567.44 g/mol |
| Exact Mass | 567.29 |
| IUPAC Name | methyl (3S)-1-[(2S)-3-[3-(difluoromethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]diazinane-3-carboxylate |
| SMILES | COC(=O)[C@@H]1CCCN(C(=O)[C@H](Cc2cc(B3OC(C)(C)C(C)(C)O3)cc(C(F)F)c2)NC(=O)OC(C)(C)C)N1 |
| InChI | InChI=1S/C27H40BF2N3O7/c1-25(2,3)38-24(36)31-20(22(34)33-11-9-10-19(32-33)23(35)37-8)14-16-12-17(21(29)30)15-18(13-16)28-39-26(4,5)27(6,7)40-28/h12-13,15,19-21,32H,9-11,14H2,1-8H3,(H,31,36)/t19-,20-/m0/s1 |
| InChIKey | VOVMNSDMTYLGJL-PMACEKPBSA-N |
| XLogP | 3.03 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|