C31H41BN2O6 — CID 58310481
tert-butyl N-[(1R)-2-oxo-1-phenyl-2-[(2S)-2-[2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetyl]pyrrolidin-1-yl]ethyl]carbamate (PubChem CID 58310481) has the molecular formula C31H41BN2O6 and a molecular weight of 548.49 g/mol. Its IUPAC name is tert-butyl N-[(1R)-2-oxo-1-phenyl-2-[(2S)-2-[2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetyl]pyrrolidin-1-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-2-oxo-1-phenyl-2-[(2S)-2-[2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetyl]pyrrolidin-1-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 58310481 |
| Molecular Formula | C31H41BN2O6 |
| Molecular Weight | 548.49 g/mol |
| Exact Mass | 548.31 |
| IUPAC Name | tert-butyl N-[(1R)-2-oxo-1-phenyl-2-[(2S)-2-[2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetyl]pyrrolidin-1-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C(=O)N1CCC[C@H]1C(=O)Cc1cccc(B2OC(C)(C)C(C)(C)O2)c1)c1ccccc1 |
| InChI | InChI=1S/C31H41BN2O6/c1-29(2,3)38-28(37)33-26(22-14-9-8-10-15-22)27(36)34-18-12-17-24(34)25(35)20-21-13-11-16-23(19-21)32-39-30(4,5)31(6,7)40-32/h8-11,13-16,19,24,26H,12,17-18,20H2,1-7H3,(H,33,37)/t24-,26+/m0/s1 |
| InChIKey | MWTSMQVXEDDOGP-AZGAKELHSA-N |
| XLogP | 4.35 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.49 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|