C25H35BFN3O5 — CID 66822312
tert-butyl N-[1-[(2S)-2-cyanopyrrolidin-1-yl]-3-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-oxopropan-2-yl]carbamate (PubChem CID 66822312) has the molecular formula C25H35BFN3O5 and a molecular weight of 487.38 g/mol. Its IUPAC name is tert-butyl N-[1-[(2S)-2-cyanopyrrolidin-1-yl]-3-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(2S)-2-cyanopyrrolidin-1-yl]-3-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 66822312 |
| Molecular Formula | C25H35BFN3O5 |
| Molecular Weight | 487.38 g/mol |
| Exact Mass | 487.27 |
| IUPAC Name | tert-butyl N-[1-[(2S)-2-cyanopyrrolidin-1-yl]-3-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-oxopropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccc(B2OC(C)(C)C(C)(C)O2)cc1F)C(=O)N1CCC[C@H]1C#N |
| InChI | InChI=1S/C25H35BFN3O5/c1-23(2,3)33-22(32)29-20(21(31)30-12-8-9-18(30)15-28)13-16-10-11-17(14-19(16)27)26-34-24(4,5)25(6,7)35-26/h10-11,14,18,20H,8-9,12-13H2,1-7H3,(H,29,32)/t18-,20?/m0/s1 |
| InChIKey | KHCKAQJTHAEGAI-LROBGIAVSA-N |
| XLogP | 3.08 |
| TPSA | 100.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|