C22H34BNO7 — CID 170790987
methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[3-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methoxy]phenyl]propanoate (PubChem CID 170790987) has the molecular formula C22H34BNO7 and a molecular weight of 435.33 g/mol. Its IUPAC name is methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[3-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methoxy]phenyl]propanoate.
| Compound Name | methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[3-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 170790987 |
| Molecular Formula | C22H34BNO7 |
| Molecular Weight | 435.33 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[3-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methoxy]phenyl]propanoate |
| SMILES | COC(=O)[C@@H](Cc1cccc(OCB2OC(C)(C)C(C)(C)O2)c1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H34BNO7/c1-20(2,3)29-19(26)24-17(18(25)27-8)13-15-10-9-11-16(12-15)28-14-23-30-21(4,5)22(6,7)31-23/h9-12,17H,13-14H2,1-8H3,(H,24,26)/t17-/m1/s1 |
| InChIKey | FFVUUKOXYOHOHF-QGZVFWFLSA-N |
| XLogP | 3.31 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.33 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|