C15H22BNO7 — CID 174209255
3-[3-(boronomethoxy)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 174209255) has the molecular formula C15H22BNO7 and a molecular weight of 339.15 g/mol. Its IUPAC name is 3-[3-(boronomethoxy)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | 3-[3-(boronomethoxy)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 174209255 |
| Molecular Formula | C15H22BNO7 |
| Molecular Weight | 339.15 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 3-[3-(boronomethoxy)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | CC(C)(C)OC(=O)NC(Cc1cccc(OCB(O)O)c1)C(=O)O |
| InChI | InChI=1S/C15H22BNO7/c1-15(2,3)24-14(20)17-12(13(18)19)8-10-5-4-6-11(7-10)23-9-16(21)22/h4-7,12,21-22H,8-9H2,1-3H3,(H,17,20)(H,18,19) |
| InChIKey | JYMZDIZWCKMJMV-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.15 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|