C15H21BFNO7 — CID 170790965
(2S)-3-[3-(boronomethoxy)-5-fluorophenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 170790965) has the molecular formula C15H21BFNO7 and a molecular weight of 357.14 g/mol. Its IUPAC name is (2S)-3-[3-(boronomethoxy)-5-fluorophenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | (2S)-3-[3-(boronomethoxy)-5-fluorophenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 170790965 |
| Molecular Formula | C15H21BFNO7 |
| Molecular Weight | 357.14 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | (2S)-3-[3-(boronomethoxy)-5-fluorophenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1cc(F)cc(OCB(O)O)c1)C(=O)O |
| InChI | InChI=1S/C15H21BFNO7/c1-15(2,3)25-14(21)18-12(13(19)20)6-9-4-10(17)7-11(5-9)24-8-16(22)23/h4-5,7,12,22-23H,6,8H2,1-3H3,(H,18,21)(H,19,20)/t12-/m0/s1 |
| InChIKey | BSSHSZXYTROEHR-LBPRGKRZSA-N |
| XLogP | 0.74 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.14 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|