C23H34BNO6 — CID 174207253
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[3-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]phenyl]propanoic acid (PubChem CID 174207253) has the molecular formula C23H34BNO6 and a molecular weight of 431.34 g/mol. Its IUPAC name is (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[3-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]phenyl]propanoic acid.
| Compound Name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[3-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 174207253 |
| Molecular Formula | C23H34BNO6 |
| Molecular Weight | 431.34 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[3-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]phenyl]propanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1cccc(C2(B3OC(C)(C)C(C)(C)O3)CC2)c1)C(=O)O |
| InChI | InChI=1S/C23H34BNO6/c1-20(2,3)29-19(28)25-17(18(26)27)14-15-9-8-10-16(13-15)23(11-12-23)24-30-21(4,5)22(6,7)31-24/h8-10,13,17H,11-12,14H2,1-7H3,(H,25,28)(H,26,27)/t17-/m0/s1 |
| InChIKey | JKSCVXBRXMBCIG-KRWDZBQOSA-N |
| XLogP | 3.87 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.34 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|