C22H33BBrNO7 — CID 150274719
methyl (2S)-3-[3-bromo-4-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 150274719) has the molecular formula C22H33BBrNO7 and a molecular weight of 514.22 g/mol. Its IUPAC name is methyl (2S)-3-[3-bromo-4-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | methyl (2S)-3-[3-bromo-4-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 150274719 |
| Molecular Formula | C22H33BBrNO7 |
| Molecular Weight | 514.22 g/mol |
| Exact Mass | 513.15 |
| IUPAC Name | methyl (2S)-3-[3-bromo-4-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | COC(=O)[C@H](Cc1cc(Br)c(OC)c(B2OC(C)(C)C(C)(C)O2)c1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H33BBrNO7/c1-20(2,3)30-19(27)25-16(18(26)29-9)12-13-10-14(17(28-8)15(24)11-13)23-31-21(4,5)22(6,7)32-23/h10-11,16H,12H2,1-9H3,(H,25,27)/t16-/m0/s1 |
| InChIKey | GEHUHUCFJARHBB-INIZCTEOSA-N |
| XLogP | 3.37 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.22 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|