C17H26BN3O4 — CID 66836707
(3S)-3-methyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]piperazine-1-carboxylic acid (PubChem CID 66836707) has the molecular formula C17H26BN3O4 and a molecular weight of 347.22 g/mol. Its IUPAC name is (3S)-3-methyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]piperazine-1-carboxylic acid.
| Compound Name | (3S)-3-methyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 66836707 |
| Molecular Formula | C17H26BN3O4 |
| Molecular Weight | 347.22 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | (3S)-3-methyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]piperazine-1-carboxylic acid |
| SMILES | C[C@H]1CN(C(=O)O)CCN1c1cc(B2OC(C)(C)C(C)(C)O2)ccn1 |
| InChI | InChI=1S/C17H26BN3O4/c1-12-11-20(15(22)23)8-9-21(12)14-10-13(6-7-19-14)18-24-16(2,3)17(4,5)25-18/h6-7,10,12H,8-9,11H2,1-5H3,(H,22,23)/t12-/m0/s1 |
| InChIKey | HBJUGDIPGYWATP-LBPRGKRZSA-N |
| XLogP | 1.57 |
| TPSA | 75.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.22 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|