C18H29BN2O2 — CID 166092276
(2R)-2,4-dimethyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine (PubChem CID 166092276) has the molecular formula C18H29BN2O2 and a molecular weight of 316.25 g/mol. Its IUPAC name is (2R)-2,4-dimethyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine.
| Compound Name | (2R)-2,4-dimethyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine |
|---|---|
| PubChem CID | 166092276 |
| Molecular Formula | C18H29BN2O2 |
| Molecular Weight | 316.25 g/mol |
| Exact Mass | 316.23 |
| IUPAC Name | (2R)-2,4-dimethyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine |
| SMILES | C[C@@H]1CN(C)CCN1c1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C18H29BN2O2/c1-14-13-20(6)11-12-21(14)16-9-7-15(8-10-16)19-22-17(2,3)18(4,5)23-19/h7-10,14H,11-13H2,1-6H3/t14-/m1/s1 |
| InChIKey | YIJLRLLOBHLIAW-CQSZACIVSA-N |
| XLogP | 2.13 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.25 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|