C14H21BN2O4 — CID 67073898
ethyl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]carbamic acid (PubChem CID 67073898) has the molecular formula C14H21BN2O4 and a molecular weight of 292.14 g/mol. Its IUPAC name is ethyl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]carbamic acid.
| Compound Name | ethyl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]carbamic acid |
|---|---|
| PubChem CID | 67073898 |
| Molecular Formula | C14H21BN2O4 |
| Molecular Weight | 292.14 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | ethyl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]carbamic acid |
| SMILES | CCN(C(=O)O)c1cc(B2OC(C)(C)C(C)(C)O2)ccn1 |
| InChI | InChI=1S/C14H21BN2O4/c1-6-17(12(18)19)11-9-10(7-8-16-11)15-20-13(2,3)14(4,5)21-15/h7-9H,6H2,1-5H3,(H,18,19) |
| InChIKey | KPMDVECZJMRGDG-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.14 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|