C29H42BN3O6 — CID 157403464
tert-butyl (5S)-5-[2-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-2-oxoethyl]-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,4,5-tetrahydro-2-benzazepine-2-carboxylate (PubChem CID 157403464) has the molecular formula C29H42BN3O6 and a molecular weight of 539.48 g/mol. Its IUPAC name is tert-butyl (5S)-5-[2-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-2-oxoethyl]-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,4,5-tetrahydro-2-benzazepine-2-carboxylate.
| Compound Name | tert-butyl (5S)-5-[2-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-2-oxoethyl]-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,4,5-tetrahydro-2-benzazepine-2-carboxylate |
|---|---|
| PubChem CID | 157403464 |
| Molecular Formula | C29H42BN3O6 |
| Molecular Weight | 539.48 g/mol |
| Exact Mass | 539.32 |
| IUPAC Name | tert-butyl (5S)-5-[2-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-2-oxoethyl]-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,4,5-tetrahydro-2-benzazepine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](CC(=O)c2nnc(C(C)(C)C)o2)c2ccc(B3OC(C)(C)C(C)(C)O3)cc2C1 |
| InChI | InChI=1S/C29H42BN3O6/c1-26(2,3)24-32-31-23(36-24)22(34)16-18-13-14-33(25(35)37-27(4,5)6)17-19-15-20(11-12-21(18)19)30-38-28(7,8)29(9,10)39-30/h11-12,15,18H,13-14,16-17H2,1-10H3/t18-/m0/s1 |
| InChIKey | YSTGKNPTBIZFIQ-SFHVURJKSA-N |
| XLogP | 5.16 |
| TPSA | 103.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.48 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|