C26H30BrN3O2 — CID 176749517
3-[5-bromo-1-(3-isocyanocyclobutyl)-2-[2-[(1S)-1-methoxyethyl]-3-pyridinyl]indol-3-yl]-2,2-dimethylpropan-1-ol (PubChem CID 176749517) has the molecular formula C26H30BrN3O2 and a molecular weight of 496.45 g/mol. Its IUPAC name is 3-[5-bromo-1-(3-isocyanocyclobutyl)-2-[2-[(1S)-1-methoxyethyl]-3-pyridinyl]indol-3-yl]-2,2-dimethylpropan-1-ol.
| Compound Name | 3-[5-bromo-1-(3-isocyanocyclobutyl)-2-[2-[(1S)-1-methoxyethyl]-3-pyridinyl]indol-3-yl]-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 176749517 |
| Molecular Formula | C26H30BrN3O2 |
| Molecular Weight | 496.45 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | 3-[5-bromo-1-(3-isocyanocyclobutyl)-2-[2-[(1S)-1-methoxyethyl]-3-pyridinyl]indol-3-yl]-2,2-dimethylpropan-1-ol |
| SMILES | [C-]#[N+]C1CC(n2c(-c3cccnc3[C@H](C)OC)c(CC(C)(C)CO)c3cc(Br)ccc32)C1 |
| InChI | InChI=1S/C26H30BrN3O2/c1-16(32-5)24-20(7-6-10-29-24)25-22(14-26(2,3)15-31)21-11-17(27)8-9-23(21)30(25)19-12-18(13-19)28-4/h6-11,16,18-19,31H,12-15H2,1-3,5H3/t16-,18?,19?/m0/s1 |
| InChIKey | CHEFDVKIQNABLW-IVMQYODDSA-N |
| XLogP | 6.36 |
| TPSA | 51.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.45 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|