C38H43N3O2Si — CID 175590852
3-[3-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylpropyl]-2-[2-(1-methoxyethyl)-3-pyridinyl]-1H-indole-5-carbonitrile (PubChem CID 175590852) has the molecular formula C38H43N3O2Si and a molecular weight of 601.87 g/mol. Its IUPAC name is 3-[3-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylpropyl]-2-[2-(1-methoxyethyl)-3-pyridinyl]-1H-indole-5-carbonitrile.
| Compound Name | 3-[3-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylpropyl]-2-[2-(1-methoxyethyl)-3-pyridinyl]-1H-indole-5-carbonitrile |
|---|---|
| PubChem CID | 175590852 |
| Molecular Formula | C38H43N3O2Si |
| Molecular Weight | 601.87 g/mol |
| Exact Mass | 601.31 |
| IUPAC Name | 3-[3-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylpropyl]-2-[2-(1-methoxyethyl)-3-pyridinyl]-1H-indole-5-carbonitrile |
| SMILES | COC(C)c1ncccc1-c1[nH]c2ccc(C#N)cc2c1CC(C)(C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C38H43N3O2Si/c1-27(42-7)35-31(19-14-22-40-35)36-33(32-23-28(25-39)20-21-34(32)41-36)24-38(5,6)26-43-44(37(2,3)4,29-15-10-8-11-16-29)30-17-12-9-13-18-30/h8-23,27,41H,24,26H2,1-7H3 |
| InChIKey | BQXPGQPWUSWLKC-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.87 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|