C25H32O2Si — CID 164787157
tert-butyl-[[(1R,2R)-2-[(1R)-1-methoxyprop-2-ynyl]cyclobutyl]methoxy]-diphenylsilane (PubChem CID 164787157) has the molecular formula C25H32O2Si and a molecular weight of 392.62 g/mol. Its IUPAC name is tert-butyl-[[(1R,2R)-2-[(1R)-1-methoxyprop-2-ynyl]cyclobutyl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(1R,2R)-2-[(1R)-1-methoxyprop-2-ynyl]cyclobutyl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 164787157 |
| Molecular Formula | C25H32O2Si |
| Molecular Weight | 392.62 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | tert-butyl-[[(1R,2R)-2-[(1R)-1-methoxyprop-2-ynyl]cyclobutyl]methoxy]-diphenylsilane |
| SMILES | C#C[C@H](OC)[C@@H]1CC[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H32O2Si/c1-6-24(26-5)23-18-17-20(23)19-27-28(25(2,3)4,21-13-9-7-10-14-21)22-15-11-8-12-16-22/h1,7-16,20,23-24H,17-19H2,2-5H3/t20-,23+,24-/m0/s1 |
| InChIKey | ZRBBROIWMGDWIB-ZTCOLXNVSA-N |
| XLogP | 4.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.62 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|