C36H42O8Si — CID 172588937
methyl 5-[3-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylpropoxy]-4-(2,6-dimethoxyphenyl)-6-oxopyran-2-carboxylate (PubChem CID 172588937) has the molecular formula C36H42O8Si and a molecular weight of 630.81 g/mol. Its IUPAC name is methyl 5-[3-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylpropoxy]-4-(2,6-dimethoxyphenyl)-6-oxopyran-2-carboxylate.
| Compound Name | methyl 5-[3-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylpropoxy]-4-(2,6-dimethoxyphenyl)-6-oxopyran-2-carboxylate |
|---|---|
| PubChem CID | 172588937 |
| Molecular Formula | C36H42O8Si |
| Molecular Weight | 630.81 g/mol |
| Exact Mass | 630.26 |
| IUPAC Name | methyl 5-[3-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylpropoxy]-4-(2,6-dimethoxyphenyl)-6-oxopyran-2-carboxylate |
| SMILES | COC(=O)c1cc(-c2c(OC)cccc2OC)c(OCC(C)(C)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)c(=O)o1 |
| InChI | InChI=1S/C36H42O8Si/c1-35(2,3)45(25-16-11-9-12-17-25,26-18-13-10-14-19-26)43-24-36(4,5)23-42-32-27(22-30(33(37)41-8)44-34(32)38)31-28(39-6)20-15-21-29(31)40-7/h9-22H,23-24H2,1-8H3 |
| InChIKey | DQLZXQKTJQZEHQ-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 93.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.81 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|