C16H16ClNO7 — CID 172588761
4-(3,5-dimethoxy-4-pyridinyl)-5-(2-methoxyethoxy)-6-oxopyran-2-carbonyl chloride (PubChem CID 172588761) has the molecular formula C16H16ClNO7 and a molecular weight of 369.76 g/mol. Its IUPAC name is 4-(3,5-dimethoxy-4-pyridinyl)-5-(2-methoxyethoxy)-6-oxopyran-2-carbonyl chloride.
| Compound Name | 4-(3,5-dimethoxy-4-pyridinyl)-5-(2-methoxyethoxy)-6-oxopyran-2-carbonyl chloride |
|---|---|
| PubChem CID | 172588761 |
| Molecular Formula | C16H16ClNO7 |
| Molecular Weight | 369.76 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | 4-(3,5-dimethoxy-4-pyridinyl)-5-(2-methoxyethoxy)-6-oxopyran-2-carbonyl chloride |
| SMILES | COCCOc1c(-c2c(OC)cncc2OC)cc(C(=O)Cl)oc1=O |
| InChI | InChI=1S/C16H16ClNO7/c1-21-4-5-24-14-9(6-10(15(17)19)25-16(14)20)13-11(22-2)7-18-8-12(13)23-3/h6-8H,4-5H2,1-3H3 |
| InChIKey | UFIZSROQMWAFJT-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 97.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.76 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|