C14H20FNO5 — CID 172587741
6-acetyl-3-(2-methoxyethoxy)-4-(prop-1-en-2-ylamino)pyran-2-one;fluoromethane (PubChem CID 172587741) has the molecular formula C14H20FNO5 and a molecular weight of 301.31 g/mol. Its IUPAC name is 6-acetyl-3-(2-methoxyethoxy)-4-(prop-1-en-2-ylamino)pyran-2-one;fluoromethane.
| Compound Name | 6-acetyl-3-(2-methoxyethoxy)-4-(prop-1-en-2-ylamino)pyran-2-one;fluoromethane |
|---|---|
| PubChem CID | 172587741 |
| Molecular Formula | C14H20FNO5 |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 6-acetyl-3-(2-methoxyethoxy)-4-(prop-1-en-2-ylamino)pyran-2-one;fluoromethane |
| SMILES | C=C(C)Nc1cc(C(C)=O)oc(=O)c1OCCOC.CF |
| InChI | InChI=1S/C13H17NO5.CH3F/c1-8(2)14-10-7-11(9(3)15)19-13(16)12(10)18-6-5-17-4;1-2/h7,14H,1,5-6H2,2-4H3;1H3 |
| InChIKey | NYEJWPHIOYRLGG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|