C14H15N3O6 — CID 172587864
methyl 5-(2-methoxyethoxy)-6-oxo-4-(pyrimidin-2-ylamino)pyran-2-carboxylate (PubChem CID 172587864) has the molecular formula C14H15N3O6 and a molecular weight of 321.29 g/mol. Its IUPAC name is methyl 5-(2-methoxyethoxy)-6-oxo-4-(pyrimidin-2-ylamino)pyran-2-carboxylate.
| Compound Name | methyl 5-(2-methoxyethoxy)-6-oxo-4-(pyrimidin-2-ylamino)pyran-2-carboxylate |
|---|---|
| PubChem CID | 172587864 |
| Molecular Formula | C14H15N3O6 |
| Molecular Weight | 321.29 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | methyl 5-(2-methoxyethoxy)-6-oxo-4-(pyrimidin-2-ylamino)pyran-2-carboxylate |
| SMILES | COCCOc1c(Nc2ncccn2)cc(C(=O)OC)oc1=O |
| InChI | InChI=1S/C14H15N3O6/c1-20-6-7-22-11-9(17-14-15-4-3-5-16-14)8-10(12(18)21-2)23-13(11)19/h3-5,8H,6-7H2,1-2H3,(H,15,16,17) |
| InChIKey | IBSOTGWAFABRLO-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.29 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|