C8H4Cl2N2O3 — CID 12564369
methyl 4,7-dichlorofuro[2,3-d]pyridazine-2-carboxylate (PubChem CID 12564369) has the molecular formula C8H4Cl2N2O3 and a molecular weight of 247.04 g/mol. Its IUPAC name is methyl 4,7-dichlorofuro[2,3-d]pyridazine-2-carboxylate.
| Compound Name | methyl 4,7-dichlorofuro[2,3-d]pyridazine-2-carboxylate |
|---|---|
| PubChem CID | 12564369 |
| Molecular Formula | C8H4Cl2N2O3 |
| Molecular Weight | 247.04 g/mol |
| Exact Mass | 245.96 |
| IUPAC Name | methyl 4,7-dichlorofuro[2,3-d]pyridazine-2-carboxylate |
| SMILES | COC(=O)c1cc2c(Cl)nnc(Cl)c2o1 |
| InChI | InChI=1S/C8H4Cl2N2O3/c1-14-8(13)4-2-3-5(15-4)7(10)12-11-6(3)9/h2H,1H3 |
| InChIKey | RXDKLHCHPMIEDD-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.04 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |