methyl 4,7-dichlorofuro[2,3-d]pyridazine-2-carboxylate

C8H4Cl2N2O3 — CID 12564369

IUPACmethyl 4,7-dichlorofuro[2,3-d]pyridazine-2-carboxylate
SMILESCOC(=O)c1cc2c(Cl)nnc(Cl)c2o1
InChIInChI=1S/C8H4Cl2N2O3/c1-14-8(13)4-2-3-5(15-4)7(10)12-11-6(3)9/h2H,1H3
InChIKeyRXDKLHCHPMIEDD-UHFFFAOYSA-N
MW247.04 g/mol
LogP2.32
Rot. Bonds1

About methyl 4,7-dichlorofuro[2,3-d]pyridazine-2-carboxylate

methyl 4,7-dichlorofuro[2,3-d]pyridazine-2-carboxylate (PubChem CID 12564369) has the molecular formula C8H4Cl2N2O3 and a molecular weight of 247.04 g/mol. Its IUPAC name is methyl 4,7-dichlorofuro[2,3-d]pyridazine-2-carboxylate.

Molecular Properties

Compound Namemethyl 4,7-dichlorofuro[2,3-d]pyridazine-2-carboxylate
PubChem CID12564369
Molecular FormulaC8H4Cl2N2O3
Molecular Weight247.04 g/mol
Exact Mass245.96
IUPAC Namemethyl 4,7-dichlorofuro[2,3-d]pyridazine-2-carboxylate
SMILESCOC(=O)c1cc2c(Cl)nnc(Cl)c2o1
InChIInChI=1S/C8H4Cl2N2O3/c1-14-8(13)4-2-3-5(15-4)7(10)12-11-6(3)9/h2H,1H3
InChIKeyRXDKLHCHPMIEDD-UHFFFAOYSA-N
XLogP2.32
TPSA65.22 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500247.04
LogP ≤ 52.32
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 4,7-dichlorofuro[2,3-d]pyridazine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4,7-dichlorofuro[2,3-d]pyridazine-2-carboxylate?
The IUPAC name of methyl 4,7-dichlorofuro[2,3-d]pyridazine-2-carboxylate (CID 12564369) is methyl 4,7-dichlorofuro[2,3-d]pyridazine-2-carboxylate.
What is the SMILES notation for methyl 4,7-dichlorofuro[2,3-d]pyridazine-2-carboxylate?
The canonical SMILES for methyl 4,7-dichlorofuro[2,3-d]pyridazine-2-carboxylate is COC(=O)c1cc2c(Cl)nnc(Cl)c2o1.
What is the InChIKey of methyl 4,7-dichlorofuro[2,3-d]pyridazine-2-carboxylate?
The InChIKey is RXDKLHCHPMIEDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4Cl2N2O3/c1-14-8(13)4-2-3-5(15-4)7(10)12-11-6(3)9/h2H,1H3.
What are the key properties of methyl 4,7-dichlorofuro[2,3-d]pyridazine-2-carboxylate?
methyl 4,7-dichlorofuro[2,3-d]pyridazine-2-carboxylate has a molecular weight of 247.04 g/mol, XLogP of 2.32, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4,7-dichlorofuro[2,3-d]pyridazine-2-carboxylate is sourced from PubChem (CID 12564369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).