C34H24O3 — CID 162398645
methyl 4,5,6,7-tetraphenyl-1-benzofuran-2-carboxylate (PubChem CID 162398645) has the molecular formula C34H24O3 and a molecular weight of 480.56 g/mol. Its IUPAC name is methyl 4,5,6,7-tetraphenyl-1-benzofuran-2-carboxylate.
| Compound Name | methyl 4,5,6,7-tetraphenyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 162398645 |
| Molecular Formula | C34H24O3 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | methyl 4,5,6,7-tetraphenyl-1-benzofuran-2-carboxylate |
| SMILES | COC(=O)c1cc2c(-c3ccccc3)c(-c3ccccc3)c(-c3ccccc3)c(-c3ccccc3)c2o1 |
| InChI | InChI=1S/C34H24O3/c1-36-34(35)28-22-27-29(23-14-6-2-7-15-23)30(24-16-8-3-9-17-24)31(25-18-10-4-11-19-25)32(33(27)37-28)26-20-12-5-13-21-26/h2-22H,1H3 |
| InChIKey | MGHCCMNVXDHPET-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |