C26H20O6 — CID 134912171
6-O-ethyl 7-O-methyl 2-oxo-3,4-diphenylchromene-6,7-dicarboxylate (PubChem CID 134912171) has the molecular formula C26H20O6 and a molecular weight of 428.44 g/mol. Its IUPAC name is 6-O-ethyl 7-O-methyl 2-oxo-3,4-diphenylchromene-6,7-dicarboxylate.
| Compound Name | 6-O-ethyl 7-O-methyl 2-oxo-3,4-diphenylchromene-6,7-dicarboxylate |
|---|---|
| PubChem CID | 134912171 |
| Molecular Formula | C26H20O6 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 6-O-ethyl 7-O-methyl 2-oxo-3,4-diphenylchromene-6,7-dicarboxylate |
| SMILES | CCOC(=O)c1cc2c(-c3ccccc3)c(-c3ccccc3)c(=O)oc2cc1C(=O)OC |
| InChI | InChI=1S/C26H20O6/c1-3-31-25(28)18-14-20-21(15-19(18)24(27)30-2)32-26(29)23(17-12-8-5-9-13-17)22(20)16-10-6-4-7-11-16/h4-15H,3H2,1-2H3 |
| InChIKey | BESLOCOWULGSMI-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|