C20H15N2O5P — CID 89098683
ethyl 2-oxo-3-(5-phenyl-1,3,4-oxadiazol-2-yl)-7-phosphanylchromene-4-carboxylate (PubChem CID 89098683) has the molecular formula C20H15N2O5P and a molecular weight of 394.32 g/mol. Its IUPAC name is ethyl 2-oxo-3-(5-phenyl-1,3,4-oxadiazol-2-yl)-7-phosphanylchromene-4-carboxylate.
| Compound Name | ethyl 2-oxo-3-(5-phenyl-1,3,4-oxadiazol-2-yl)-7-phosphanylchromene-4-carboxylate |
|---|---|
| PubChem CID | 89098683 |
| Molecular Formula | C20H15N2O5P |
| Molecular Weight | 394.32 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | ethyl 2-oxo-3-(5-phenyl-1,3,4-oxadiazol-2-yl)-7-phosphanylchromene-4-carboxylate |
| SMILES | CCOC(=O)c1c(-c2nnc(-c3ccccc3)o2)c(=O)oc2cc(P)ccc12 |
| InChI | InChI=1S/C20H15N2O5P/c1-2-25-19(23)15-13-9-8-12(28)10-14(13)26-20(24)16(15)18-22-21-17(27-18)11-6-4-3-5-7-11/h3-10H,2,28H2,1H3 |
| InChIKey | NBPAEUBDXWRCKJ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 95.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|