About 4-anilino-5-methoxy-6-oxopyran-2-carboxylic acid;ethane;methane
4-anilino-5-methoxy-6-oxopyran-2-carboxylic acid;ethane;methane (PubChem CID 172587807) has the molecular formula C16H21NO5
and a molecular weight of 307.35 g/mol. Its IUPAC name is 4-anilino-5-methoxy-6-oxopyran-2-carboxylic acid;ethane;methane.
Molecular Properties
| Compound Name | 4-anilino-5-methoxy-6-oxopyran-2-carboxylic acid;ethane;methane |
| PubChem CID | 172587807 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 4-anilino-5-methoxy-6-oxopyran-2-carboxylic acid;ethane;methane |
| SMILES | C.CC.COc1c(Nc2ccccc2)cc(C(=O)O)oc1=O |
| InChI | InChI=1S/C13H11NO5.C2H6.CH4/c1-18-11-9(14-8-5-3-2-4-6-8)7-10(12(15)16)19-13(11)17;1-2;/h2-7,14H,1H3,(H,15,16);1-2H3;1H4 |
| InChIKey | NSCWVQITWWCMAZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-anilino-5-methoxy-6-oxopyran-2-carboxylic acid;ethane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-anilino-5-methoxy-6-oxopyran-2-carboxylic acid;ethane;methane?
The IUPAC name of 4-anilino-5-methoxy-6-oxopyran-2-carboxylic acid;ethane;methane (CID 172587807) is 4-anilino-5-methoxy-6-oxopyran-2-carboxylic acid;ethane;methane.
What is the SMILES notation for 4-anilino-5-methoxy-6-oxopyran-2-carboxylic acid;ethane;methane?
The canonical SMILES for 4-anilino-5-methoxy-6-oxopyran-2-carboxylic acid;ethane;methane is C.CC.COc1c(Nc2ccccc2)cc(C(=O)O)oc1=O.
What is the InChIKey of 4-anilino-5-methoxy-6-oxopyran-2-carboxylic acid;ethane;methane?
The InChIKey is NSCWVQITWWCMAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO5.C2H6.CH4/c1-18-11-9(14-8-5-3-2-4-6-8)7-10(12(15)16)19-13(11)17;1-2;/h2-7,14H,1H3,(H,15,16);1-2H3;1H4.
What are the key properties of 4-anilino-5-methoxy-6-oxopyran-2-carboxylic acid;ethane;methane?
4-anilino-5-methoxy-6-oxopyran-2-carboxylic acid;ethane;methane has a molecular weight of 307.35 g/mol, XLogP of 3.75, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-anilino-5-methoxy-6-oxopyran-2-carboxylic acid;ethane;methane is sourced from PubChem (CID 172587807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).