C8H9NO4 — CID 54199038
4,5-dimethoxypyridine-3-carboxylic acid (PubChem CID 54199038) has the molecular formula C8H9NO4 and a molecular weight of 183.16 g/mol. Its IUPAC name is 4,5-dimethoxypyridine-3-carboxylic acid.
| Compound Name | 4,5-dimethoxypyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 54199038 |
| Molecular Formula | C8H9NO4 |
| Molecular Weight | 183.16 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 4,5-dimethoxypyridine-3-carboxylic acid |
| SMILES | COc1cncc(C(=O)O)c1OC |
| InChI | InChI=1S/C8H9NO4/c1-12-6-4-9-3-5(8(10)11)7(6)13-2/h3-4H,1-2H3,(H,10,11) |
| InChIKey | PNXKUPMFHZNAEU-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.16 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |