C8H10N2O3 — CID 69277472
3,5-dimethoxypyridine-4-carboxamide (PubChem CID 69277472) has the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. Its IUPAC name is 3,5-dimethoxypyridine-4-carboxamide.
| Compound Name | 3,5-dimethoxypyridine-4-carboxamide |
|---|---|
| PubChem CID | 69277472 |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | 3,5-dimethoxypyridine-4-carboxamide |
| SMILES | COc1cncc(OC)c1C(N)=O |
| InChI | InChI=1S/C8H10N2O3/c1-12-5-3-10-4-6(13-2)7(5)8(9)11/h3-4H,1-2H3,(H2,9,11) |
| InChIKey | RZRMMCBEOQIADB-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |