5-methoxypyridine-3,4-dicarboxylic acid

C8H7NO5 — CID 15257827

IUPAC5-methoxypyridine-3,4-dicarboxylic acid
SMILESCOc1cncc(C(=O)O)c1C(=O)O
InChIInChI=1S/C8H7NO5/c1-14-5-3-9-2-4(7(10)11)6(5)8(12)13/h2-3H,1H3,(H,10,11)(H,12,13)
InChIKeyOOXKBAMSXVLLRQ-UHFFFAOYSA-N
MW197.15 g/mol
LogP0.49
Rot. Bonds3

About 5-methoxypyridine-3,4-dicarboxylic acid

5-methoxypyridine-3,4-dicarboxylic acid (PubChem CID 15257827) has the molecular formula C8H7NO5 and a molecular weight of 197.15 g/mol. Its IUPAC name is 5-methoxypyridine-3,4-dicarboxylic acid.

Molecular Properties

Compound Name5-methoxypyridine-3,4-dicarboxylic acid
PubChem CID15257827
Molecular FormulaC8H7NO5
Molecular Weight197.15 g/mol
Exact Mass197.03
IUPAC Name5-methoxypyridine-3,4-dicarboxylic acid
SMILESCOc1cncc(C(=O)O)c1C(=O)O
InChIInChI=1S/C8H7NO5/c1-14-5-3-9-2-4(7(10)11)6(5)8(12)13/h2-3H,1H3,(H,10,11)(H,12,13)
InChIKeyOOXKBAMSXVLLRQ-UHFFFAOYSA-N
XLogP0.49
TPSA96.72 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500197.15
LogP ≤ 50.49
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 5-methoxypyridine-3,4-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-methoxypyridine-3,4-dicarboxylic acid?
The IUPAC name of 5-methoxypyridine-3,4-dicarboxylic acid (CID 15257827) is 5-methoxypyridine-3,4-dicarboxylic acid.
What is the SMILES notation for 5-methoxypyridine-3,4-dicarboxylic acid?
The canonical SMILES for 5-methoxypyridine-3,4-dicarboxylic acid is COc1cncc(C(=O)O)c1C(=O)O.
What is the InChIKey of 5-methoxypyridine-3,4-dicarboxylic acid?
The InChIKey is OOXKBAMSXVLLRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO5/c1-14-5-3-9-2-4(7(10)11)6(5)8(12)13/h2-3H,1H3,(H,10,11)(H,12,13).
What are the key properties of 5-methoxypyridine-3,4-dicarboxylic acid?
5-methoxypyridine-3,4-dicarboxylic acid has a molecular weight of 197.15 g/mol, XLogP of 0.49, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxypyridine-3,4-dicarboxylic acid is sourced from PubChem (CID 15257827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).