C8H7Cl2NO2 — CID 118588801
2,4-dichloro-6-methoxybenzamide (PubChem CID 118588801) has the molecular formula C8H7Cl2NO2 and a molecular weight of 220.06 g/mol. Its IUPAC name is 2,4-dichloro-6-methoxybenzamide.
| Compound Name | 2,4-dichloro-6-methoxybenzamide |
|---|---|
| PubChem CID | 118588801 |
| Molecular Formula | C8H7Cl2NO2 |
| Molecular Weight | 220.06 g/mol |
| Exact Mass | 218.99 |
| IUPAC Name | 2,4-dichloro-6-methoxybenzamide |
| SMILES | COc1cc(Cl)cc(Cl)c1C(N)=O |
| InChI | InChI=1S/C8H7Cl2NO2/c1-13-6-3-4(9)2-5(10)7(6)8(11)12/h2-3H,1H3,(H2,11,12) |
| InChIKey | OBQWQUNCQCNYHD-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.06 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |