C11H10Cl2O2 — CID 82554125
cyclopropyl-(2,4-dichloro-6-methoxyphenyl)methanone (PubChem CID 82554125) has the molecular formula C11H10Cl2O2 and a molecular weight of 245.10 g/mol. Its IUPAC name is cyclopropyl-(2,4-dichloro-6-methoxyphenyl)methanone.
| Compound Name | cyclopropyl-(2,4-dichloro-6-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 82554125 |
| Molecular Formula | C11H10Cl2O2 |
| Molecular Weight | 245.10 g/mol |
| Exact Mass | 244.01 |
| IUPAC Name | cyclopropyl-(2,4-dichloro-6-methoxyphenyl)methanone |
| SMILES | COc1cc(Cl)cc(Cl)c1C(=O)C1CC1 |
| InChI | InChI=1S/C11H10Cl2O2/c1-15-9-5-7(12)4-8(13)10(9)11(14)6-2-3-6/h4-6H,2-3H2,1H3 |
| InChIKey | DZMFVNABTHRNGW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.10 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |