C12H13ClO3 — CID 82268057
(4-chloro-2,5-dimethoxyphenyl)-cyclopropylmethanone (PubChem CID 82268057) has the molecular formula C12H13ClO3 and a molecular weight of 240.69 g/mol. Its IUPAC name is (4-chloro-2,5-dimethoxyphenyl)-cyclopropylmethanone.
| Compound Name | (4-chloro-2,5-dimethoxyphenyl)-cyclopropylmethanone |
|---|---|
| PubChem CID | 82268057 |
| Molecular Formula | C12H13ClO3 |
| Molecular Weight | 240.69 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | (4-chloro-2,5-dimethoxyphenyl)-cyclopropylmethanone |
| SMILES | COc1cc(C(=O)C2CC2)c(OC)cc1Cl |
| InChI | InChI=1S/C12H13ClO3/c1-15-10-6-9(13)11(16-2)5-8(10)12(14)7-3-4-7/h5-7H,3-4H2,1-2H3 |
| InChIKey | BKSCUYNBZWVFOQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.69 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |