C11H11Cl2NO2 — CID 116916762
azetidin-3-yl-(2,5-dichloro-4-methoxyphenyl)methanone (PubChem CID 116916762) has the molecular formula C11H11Cl2NO2 and a molecular weight of 260.12 g/mol. Its IUPAC name is azetidin-3-yl-(2,5-dichloro-4-methoxyphenyl)methanone.
| Compound Name | azetidin-3-yl-(2,5-dichloro-4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 116916762 |
| Molecular Formula | C11H11Cl2NO2 |
| Molecular Weight | 260.12 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | azetidin-3-yl-(2,5-dichloro-4-methoxyphenyl)methanone |
| SMILES | COc1cc(Cl)c(C(=O)C2CNC2)cc1Cl |
| InChI | InChI=1S/C11H11Cl2NO2/c1-16-10-3-8(12)7(2-9(10)13)11(15)6-4-14-5-6/h2-3,6,14H,4-5H2,1H3 |
| InChIKey | GCRPVCUECMDDTH-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.12 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |