C16H20O3 — CID 116920294
4-(2-methoxy-4,6-dimethylbenzoyl)cyclohexan-1-one (PubChem CID 116920294) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is 4-(2-methoxy-4,6-dimethylbenzoyl)cyclohexan-1-one.
| Compound Name | 4-(2-methoxy-4,6-dimethylbenzoyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 116920294 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 4-(2-methoxy-4,6-dimethylbenzoyl)cyclohexan-1-one |
| SMILES | COc1cc(C)cc(C)c1C(=O)C1CCC(=O)CC1 |
| InChI | InChI=1S/C16H20O3/c1-10-8-11(2)15(14(9-10)19-3)16(18)12-4-6-13(17)7-5-12/h8-9,12H,4-7H2,1-3H3 |
| InChIKey | GRPWCQWFURREPU-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |