C8H8Cl2O — CID 23462582
1,5-dichloro-3-methoxy-2-methylbenzene (PubChem CID 23462582) has the molecular formula C8H8Cl2O and a molecular weight of 191.06 g/mol. Its IUPAC name is 1,5-dichloro-3-methoxy-2-methylbenzene.
| Compound Name | 1,5-dichloro-3-methoxy-2-methylbenzene |
|---|---|
| PubChem CID | 23462582 |
| Molecular Formula | C8H8Cl2O |
| Molecular Weight | 191.06 g/mol |
| Exact Mass | 190.00 |
| IUPAC Name | 1,5-dichloro-3-methoxy-2-methylbenzene |
| SMILES | COc1cc(Cl)cc(Cl)c1C |
| InChI | InChI=1S/C8H8Cl2O/c1-5-7(10)3-6(9)4-8(5)11-2/h3-4H,1-2H3 |
| InChIKey | XZZMTXDAMUGXEB-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.06 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |