C11H14N2O5 — CID 134102474
methyl N-(2-carbamoyl-3,6-dimethoxyphenyl)carbamate (PubChem CID 134102474) has the molecular formula C11H14N2O5 and a molecular weight of 254.24 g/mol. Its IUPAC name is methyl N-(2-carbamoyl-3,6-dimethoxyphenyl)carbamate.
| Compound Name | methyl N-(2-carbamoyl-3,6-dimethoxyphenyl)carbamate |
|---|---|
| PubChem CID | 134102474 |
| Molecular Formula | C11H14N2O5 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | methyl N-(2-carbamoyl-3,6-dimethoxyphenyl)carbamate |
| SMILES | COC(=O)Nc1c(OC)ccc(OC)c1C(N)=O |
| InChI | InChI=1S/C11H14N2O5/c1-16-6-4-5-7(17-2)9(8(6)10(12)14)13-11(15)18-3/h4-5H,1-3H3,(H2,12,14)(H,13,15) |
| InChIKey | MWPSEUFMICGBGQ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |