C15H15NO3 — CID 68897697
2,6-dimethoxy-3-phenylbenzamide (PubChem CID 68897697) has the molecular formula C15H15NO3 and a molecular weight of 257.29 g/mol. Its IUPAC name is 2,6-dimethoxy-3-phenylbenzamide.
| Compound Name | 2,6-dimethoxy-3-phenylbenzamide |
|---|---|
| PubChem CID | 68897697 |
| Molecular Formula | C15H15NO3 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 2,6-dimethoxy-3-phenylbenzamide |
| SMILES | COc1ccc(-c2ccccc2)c(OC)c1C(N)=O |
| InChI | InChI=1S/C15H15NO3/c1-18-12-9-8-11(10-6-4-3-5-7-10)14(19-2)13(12)15(16)17/h3-9H,1-2H3,(H2,16,17) |
| InChIKey | IAAQVCUMAMJMSR-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |