About (3-methoxy-4-pyridinyl) carbamate
(3-methoxy-4-pyridinyl) carbamate (PubChem CID 90285344) has the molecular formula C7H8N2O3
and a molecular weight of 168.15 g/mol. Its IUPAC name is (3-methoxy-4-pyridinyl) carbamate.
Molecular Properties
| Compound Name | (3-methoxy-4-pyridinyl) carbamate |
| PubChem CID | 90285344 |
| Molecular Formula | C7H8N2O3 |
| Molecular Weight | 168.15 g/mol |
| Exact Mass | 168.05 |
| IUPAC Name | (3-methoxy-4-pyridinyl) carbamate |
| SMILES | COc1cnccc1OC(N)=O |
| InChI | InChI=1S/C7H8N2O3/c1-11-6-4-9-3-2-5(6)12-7(8)10/h2-4H,1H3,(H2,8,10) |
| InChIKey | PPKMTZORRSSHPJ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.15 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-methoxy-4-pyridinyl) carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methoxy-4-pyridinyl) carbamate?
The IUPAC name of (3-methoxy-4-pyridinyl) carbamate (CID 90285344) is (3-methoxy-4-pyridinyl) carbamate.
What is the SMILES notation for (3-methoxy-4-pyridinyl) carbamate?
The canonical SMILES for (3-methoxy-4-pyridinyl) carbamate is COc1cnccc1OC(N)=O.
What is the InChIKey of (3-methoxy-4-pyridinyl) carbamate?
The InChIKey is PPKMTZORRSSHPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O3/c1-11-6-4-9-3-2-5(6)12-7(8)10/h2-4H,1H3,(H2,8,10).
What are the key properties of (3-methoxy-4-pyridinyl) carbamate?
(3-methoxy-4-pyridinyl) carbamate has a molecular weight of 168.15 g/mol, XLogP of 0.55, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methoxy-4-pyridinyl) carbamate is sourced from PubChem (CID 90285344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).