C31H40O3Si — CID 150353604
6-[tert-butyl(diphenyl)silyl]oxy-1-(4-methoxyphenyl)-5,5-dimethylhexan-3-one (PubChem CID 150353604) has the molecular formula C31H40O3Si and a molecular weight of 488.74 g/mol. Its IUPAC name is 6-[tert-butyl(diphenyl)silyl]oxy-1-(4-methoxyphenyl)-5,5-dimethylhexan-3-one.
| Compound Name | 6-[tert-butyl(diphenyl)silyl]oxy-1-(4-methoxyphenyl)-5,5-dimethylhexan-3-one |
|---|---|
| PubChem CID | 150353604 |
| Molecular Formula | C31H40O3Si |
| Molecular Weight | 488.74 g/mol |
| Exact Mass | 488.27 |
| IUPAC Name | 6-[tert-butyl(diphenyl)silyl]oxy-1-(4-methoxyphenyl)-5,5-dimethylhexan-3-one |
| SMILES | COc1ccc(CCC(=O)CC(C)(C)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C31H40O3Si/c1-30(2,3)35(28-13-9-7-10-14-28,29-15-11-8-12-16-29)34-24-31(4,5)23-26(32)20-17-25-18-21-27(33-6)22-19-25/h7-16,18-19,21-22H,17,20,23-24H2,1-6H3 |
| InChIKey | GUGGBUMRNHYBPL-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.74 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|